CAS 81948-57-4

2-Methoxy[1,1′-biphenyl]-3-methanol

Description:

2-Methoxy[1,1′-biphenyl]-3-methanol, with the CAS number 81948-57-4, is an organic compound characterized by its biphenyl structure substituted with methoxy and hydroxymethyl groups. This compound features a methoxy group (-OCH3) attached to one of the phenyl rings and a hydroxymethyl group (-CH2OH) at the 3-position of the biphenyl framework. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both methoxy and hydroxymethyl groups contributes to its potential solubility in organic solvents and its reactivity in various chemical reactions, such as nucleophilic substitutions or oxidation processes. The compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and materials science. Its physical properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₄H₁₄O₂

InChI: InChI=1S/C14H14O2/c1-16-14-12(10-15)8-5-9-13(14)11-6-3-2-4-7-11/h2-9,15H,10H2,1H3

InChI key: InChIKey=XHWWAHIOVHNULY-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1CO)C2=CC=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-methanol, 2-methoxy-
• 2-Methoxy[1,1′-biphenyl]-3-methanol
• (2-Methoxy-3-phenylphenyl)methanol

(2-Methoxy-[1,1'-biphenyl]-3-yl)methanol

CAS: 81948-57-4

(2-Methoxy-[1,1'-biphenyl]-3-yl)methanol

Purity: 95%

Molecular weight: 214.26g/mol

Ref: 54-OR1047955