CAS 819867-21-5

2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl

Description:

2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl is a chemical compound characterized by its unique structure, which includes a biphenyl core substituted with two methoxy groups and a di-tert-butylphosphino group. This compound is notable for its role as a ligand in coordination chemistry, particularly in catalysis and organometallic chemistry. The presence of the bulky di-tert-butylphosphino group enhances its steric properties, making it effective in stabilizing metal complexes. The methoxy groups contribute to the compound's solubility and electronic properties, influencing its reactivity and interaction with metal centers. Additionally, the compound's phosphine functionality allows for strong coordination with transition metals, facilitating various catalytic processes. Its structural features and functional groups make it a valuable component in the development of new catalytic systems and materials in synthetic chemistry. Overall, 2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl exemplifies the intersection of organic and inorganic chemistry, showcasing the importance of ligands in enhancing the efficiency of chemical reactions.

Formula: C₂₂H₃₁O₂P

InChI: InChI=1S/C22H31O2P/c1-21(2,3)25(22(4,5)6)19-15-10-9-12-16(19)20-17(23-7)13-11-14-18(20)24-8/h9-15H,1-8H3

SMILES: CC(C)(C)P(c1ccccc1c1c(cccc1OC)OC)C(C)(C)C

Synonyms:

• Di-tert-butyl(2',6'-dimethoxy-[1,1'-biphenyl]-2-yl)phosphine

2-(Di-tert-butylphosphino)-2',6'-dimethoxybiphenyl

CAS: 819867-21-5

Formula: C₂₂H₃₁O₂P

Purity: 98%

Color and Shape: Solid

Molecular weight: 358.4541

Ref: IN-DA008KS2

Di-Tert-Butyl(2',6'-Dimethoxy-[1,1'-Biphenyl]-2-Yl)Phosphine

CAS: 819867-21-5

Di-Tert-Butyl(2',6'-Dimethoxy-[1,1'-Biphenyl]-2-Yl)Phosphine

Purity: 98%

Molecular weight: 358.45g/mol

Ref: 54-OR1025690

Di-tert-butyl(2′,6′-dimethoxy-[1,1′-biphenyl]-2-yl)phosphine

CAS: 819867-21-5

Formula: C₂₂H₃₁O₂P

Purity: 98%

Molecular weight: 358.462

Ref: 10-F222595