CymitQuimica logo

CAS 819867-24-8

:

2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl

Description:
2-(Diphenylphosphino)-2',6'-dimethoxybiphenyl, with the CAS number 819867-24-8, is a chemical compound that belongs to the class of organophosphorus compounds. It features a biphenyl backbone substituted with two methoxy groups and a diphenylphosphino group, which contributes to its unique properties. This compound is typically characterized by its ability to act as a ligand in coordination chemistry, particularly in transition metal complexes, enhancing catalytic activity in various reactions. The presence of the diphenylphosphino group allows for strong coordination with metals, making it valuable in applications such as catalysis and organic synthesis. Additionally, the methoxy substituents can influence the electronic properties and steric hindrance of the molecule, affecting its reactivity and solubility in different solvents. Overall, this compound is of interest in both academic research and industrial applications due to its versatile chemical behavior and potential utility in developing new catalytic systems.
Formula:C26H23O2P
InChI:InChI=1S/C26H23O2P/c1-27-23-17-11-18-24(28-2)26(23)22-16-9-10-19-25(22)29(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-19H,1-2H3
InChI key:SCPQRAVWOIURIW-UHFFFAOYSA-N
SMILES:COC1=C(C(=CC=C1)OC)C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4
Found 4 products.