CAS 82-09-7

α-Toxicarol

Description:

α-Toxicarol, with the CAS number 82-09-7, is a chemical compound classified as a bicyclic sesquiterpene. It is primarily derived from the plant species of the genus *Toxicodendron*, which includes poison ivy and poison oak. This compound is known for its structural complexity, featuring a unique arrangement of carbon atoms that contributes to its biological activity. α-Toxicarol exhibits moderate to high toxicity, particularly in certain biological systems, and has been studied for its potential effects on human health and the environment. Its chemical properties include a relatively low solubility in water, but it can dissolve in organic solvents, which is typical for many terpenes. The compound's reactivity can lead to various interactions with biological molecules, making it of interest in toxicological studies. Due to its toxic nature, handling α-Toxicarol requires caution, and it is important to follow safety protocols to minimize exposure. Overall, α-Toxicarol serves as a significant example of the diverse and complex chemistry found in natural products.

Formula: C₂₃H₂₂O₇

InChI: InChI=1S/C23H22O7/c1-23(2)6-5-11-15(30-23)8-13(24)20-21(25)19-12-7-16(26-3)17(27-4)9-14(12)28-10-18(19)29-22(11)20/h5-9,18-19,24H,10H2,1-4H3/t18-,19+/m1/s1

InChI key: InChIKey=JLTNCZQNGBLBGO-MOPGFXCFSA-N

SMILES: O=C1[C@]2(C=3C(=CC(OC)=C(OC)C3)OC[C@]2(OC=4C1=C(O)C=C5C4C=CC(C)(C)O5)[H])[H]

Synonyms:

• α-Toxicarol
• 3H-Bis[1]benzopyrano[3,4-b:6′,5′-e]pyran-7(7aH)-one, 13,13a-dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-, (7aS-cis)-
• (7aS,13aS)-13,13a-Dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis[1]benzopyrano[3,4-b:6′,5′-e]pyran-7(7aH)-one
• 3H-Bis[1]benzopyrano[3,4-b:6′,5′-e]pyran-7(7aH)-one, 13,13a-dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-, (7aS,13aS)-
• 3H-Bis[1]benzopyrano[3,4-b:6′,5′-e]pyran-7(7aH)-one, 13,13a-dihydro-6-hydroxy-9,10-dimethoxy-3,3-dimethyl-

α-Toxicarol

CAS: 82-09-7

Alpha-Toxicarol exhibits a marked inhibitory effect on mouse skin tumor promotion in an in vivo two-stage carcinogenesis test.

Formula: C₂₃H₂₂O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 410.42

Ref: TM-TN3392

α-Toxicarol

CAS: 82-09-7

Formula: C₂₃H₂₂O₇

Purity: 95%~99%

Molecular weight: 410.422

Ref: BP-SBP03033

5-Hydroxydequelin

CAS: 82-09-7

5-Hydroxydequelin is an innovative compound, classified as a natural product, which is isolated from specific microbial sources known for producing bioactive molecules. This compound is particularly noted for its ability to interact with cellular pathways, potentially modifying biological responses through its unique mode of action. It operates by binding to specific proteins or receptors, influencing various biochemical processes within the cell.

Formula: C₂₀H₂₂O₇

Purity: Min. 95%

Molecular weight: 374.38 g/mol

Ref: 3D-FH157107