CAS 82-20-2
:1,5-Bis[(4-methylphenyl)amino]-9,10-anthracenedione
Description:
1,5-Bis[(4-methylphenyl)amino]-9,10-anthracenedione, commonly referred to as a derivative of anthracenedione, is an organic compound characterized by its distinct structure, which includes two 4-methylphenylamino groups attached to the 1 and 5 positions of the anthracenedione core. This compound typically exhibits a deep red to purple color, indicative of its conjugated system, which allows for strong light absorption and potential applications in dyes and pigments. It is known for its stability under various conditions, although it may be sensitive to strong oxidizing agents. The presence of the amino groups enhances its solubility in organic solvents, making it useful in various chemical applications, including organic electronics and photonic devices. Additionally, its potential biological activity has been explored, particularly in the context of antitumor properties. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C28H22N2O2
InChI:InChI=1S/C28H22N2O2/c1-17-9-13-19(14-10-17)29-23-7-3-5-21-25(23)27(31)22-6-4-8-24(26(22)28(21)32)30-20-15-11-18(2)12-16-20/h3-16,29-30H,1-2H3
InChI key:InChIKey=ZKIVUFFTMWIBCO-UHFFFAOYSA-N
SMILES:N(C1=C2C(C(=O)C=3C(C2=O)=CC=CC3NC4=CC=C(C)C=C4)=CC=C1)C5=CC=C(C)C=C5
Synonyms:- 1,5-Bis[(4-methylphenyl)amino]-9,10-anthracenedione
- 1,5-Di-p-toluidinoanthraquinone
- 9,10-Anthracenedione, 1,5-bis((4-methylphenyl)amino)-
- Anthraquinone, 1,5-di-p-toluidino-
- Anthraquinone, 1,5-di-p-toluidino- (8CI)
- Nsc 13985
- Violet 3R base
- 1,5-Bis((4-methylphenyl)amino)anthraquinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,5-Di-p-toluidinoanthraquinone
CAS:Controlled ProductFormula:C28H22N2O2Color and Shape:NeatMolecular weight:418.49
