
CAS 82-65-5
:2H-Naphth[1,8-cd]isothiazole-3,5-disulfonic acid, 1,1-dioxide
Description:
2H-Naphth[1,8-cd]isothiazole-3,5-disulfonic acid, 1,1-dioxide, commonly referred to by its CAS number 82-65-5, is a synthetic organic compound characterized by its unique structure that includes a naphthalene core fused with an isothiazole ring. This compound features two sulfonic acid groups, which contribute to its high water solubility and make it useful in various applications, particularly in biological and analytical chemistry. The presence of the sulfonic acid groups enhances its ionic character, allowing it to interact effectively with biological molecules and serve as a potential dye or indicator. Additionally, the compound's structure may exhibit fluorescence properties, making it valuable in fluorescence microscopy and other imaging techniques. Its stability under a range of conditions and ability to form complexes with metal ions further expand its utility in research and industrial applications. Overall, 2H-Naphth[1,8-cd]isothiazole-3,5-disulfonic acid, 1,1-dioxide is a versatile compound with significant relevance in scientific studies.
Formula:C10H7NO8S3
InChI:InChI=1S/C10H7NO8S3/c12-20(13)6-3-1-2-5-7(21(14,15)16)4-8(22(17,18)19)10(11-20)9(5)6/h1-4,11H,(H,14,15,16)(H,17,18,19)
InChI key:InChIKey=SOEOLOYSOQPCII-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C2=C3C(=C(S(=O)(=O)O)C1)C=CC=C3S(=O)(=O)N2
Synonyms:- 2H-Naphth[1,8-cd]isothiazole-3,5-disulfonic acid, 1,1-dioxide
- 1,8-Naphthsultam-2,4-disulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.