CAS 82001-54-5

4-Mercaptocyclohexanecarboxylic acid

Description:

4-Mercaptocyclohexanecarboxylic acid is an organic compound characterized by the presence of both a thiol (-SH) and a carboxylic acid (-COOH) functional group, which contributes to its reactivity and potential applications in various fields. The compound features a cyclohexane ring, making it a cyclic structure that can exhibit unique stereochemistry and conformational properties. The thiol group imparts nucleophilic characteristics, allowing it to participate in various chemical reactions, including disulfide bond formation and metal ion coordination. The carboxylic acid group provides acidic properties, enabling the compound to engage in acid-base reactions. This dual functionality makes 4-Mercaptocyclohexanecarboxylic acid useful in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, its ability to form stable complexes with metals can be exploited in catalysis and materials science. Overall, the compound's unique structure and functional groups contribute to its versatility in chemical applications.

Formula: C₇H₁₂O₂S

InChI: InChI=1S/C7H12O2S/c8-7(9)5-1-3-6(10)4-2-5/h5-6,10H,1-4H2,(H,8,9)

InChI key: InChIKey=KLFCJRIFKLBIEU-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCC(S)CC1

Synonyms:

• 4-Mercaptocyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 4-mercapto-