CAS 82005-12-7
:Hymenialdisine
Description:
Hymenialdisine is a naturally occurring alkaloid primarily isolated from marine sponges, particularly those belonging to the genus Hymeniacidon. It is characterized by its complex molecular structure, which includes a bicyclic framework. This compound exhibits notable biological activity, particularly as an inhibitor of protein kinases, which are crucial for various cellular processes. Hymenialdisine has garnered interest in medicinal chemistry due to its potential therapeutic applications, including anti-cancer properties. Its mechanism of action involves the modulation of signaling pathways, making it a subject of research in drug development. Additionally, hymenialdisine is known for its low toxicity in certain biological contexts, although further studies are necessary to fully understand its pharmacokinetics and safety profile. The compound is typically studied in the context of marine natural products and their potential applications in pharmaceuticals, highlighting the importance of marine biodiversity in drug discovery.
Formula:C11H10BrN5O2
InChI:InChI=1S/C11H10BrN5O2/c12-6-3-5-4(7-10(19)17-11(13)16-7)1-2-14-9(18)8(5)15-6/h3,15H,1-2H2,(H,14,18)(H3,13,16,17,19)/b7-4-
InChI key:InChIKey=ATBAETXFFCOZOY-DAXSKMNVSA-N
SMILES:O=C1C2=C(/C(/CCN1)=C\3/C(=O)N=C(N)N3)C=C(Br)N2
Synonyms:- (4E)-4-(2-amino-5-oxo-1,5-dihydro-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydropyrrolo[2,3-c]azepin-8(1H)-one
- (4Z)-4-(2-Amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydropyrrolo[2,3-c]azepin-8(1H)-one
- (Z)-Hymenialdisine
- 10Z-Hymenialdisine
- Hymenialdesine
- Hymenialdisine
- Pyrrolo[2,3-c]azepin-8(1H)-one, 4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydro-, (4Z)-
- Pyrrolo[2,3-c]azepin-8(1H)-one, 4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydro-, (Z)-
- pyrrolo[2,3-c]azepin-8(1H)-one, 4-(2-amino-1,5-dihydro-5-oxo-4H-imidazol-4-ylidene)-2-bromo-4,5,6,7-tetrahydro-, (4E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hymenialdisine Methanoate
CAS:Controlled Product<p>Applications A potent inhibitor of a variety of kinases including MEK-1, GSK-3Β, and CKI. It also exhibits inhibition of the G2 cell cycle checkpoint at the micromolar concentrations. A marine sponge alkaloid, a natural product.<br>References Cheetham, G., et al.: J. Biol. Chem., 277, 42419 (2002), Bain, J., et al.: Biochem. J., 371, 199 (2003), Sharma, V., et al.: Bioorg. Med. Chem. Lett., 14, 4319 (2004), Anamika, et al.: Proteins, 58, 180 (2005), Birault, V., et al.: Curr. Med. Chem., 13, 1735 (2006),<br></p>Formula:C11H10BrN5O2·x(CH4O)Color and Shape:NeatMolecular weight:324.13 + x(32.04)10Z-Hymenialdisine
CAS:Pan kinase inhibitorFormula:C11H10BrN5O2Purity:98%Color and Shape:Light Yellow SolidMolecular weight:324.13


