CAS 82006-58-4

(2E)-5-fluoropent-2-ene-1,4-diamine

Description:

(2E)-5-fluoropent-2-ene-1,4-diamine is an organic compound characterized by its unique structure, which includes a pentene backbone with a fluorine substituent and two amine functional groups. The "2E" designation indicates that the double bond between the second and third carbon atoms is in the trans configuration, which influences its geometric and physical properties. The presence of the fluorine atom enhances the compound's reactivity and can affect its biological activity, making it of interest in medicinal chemistry. The amine groups contribute to its basicity and potential for hydrogen bonding, which can influence solubility and interaction with biological targets. This compound may exhibit specific stereochemical properties due to the configuration of its double bond and the spatial arrangement of its functional groups. Its CAS number, 82006-58-4, allows for easy identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals. Overall, (2E)-5-fluoropent-2-ene-1,4-diamine is a compound with significant potential for further study and application.

Formula: C₅H₁₁FN₂

InChI: InChI=1/C5H11FN2/c6-4-5(8)2-1-3-7/h1-2,5H,3-4,7-8H2/b2-1+

Synonyms:

• 2-pentene-1,4-diamine, 5-fluoro-, (2E)-