
CAS 82017-32-1
:N-Cyclopentyl-L-alanine
Description:
N-Cyclopentyl-L-alanine is an amino acid derivative characterized by the presence of a cyclopentyl group attached to the nitrogen atom of the amino group. This compound features a chiral center, making it optically active, and it is classified as a non-polar, hydrophobic amino acid due to the cyclopentyl side chain. The molecular structure includes a carboxylic acid functional group, which is typical of amino acids, contributing to its ability to participate in peptide bond formation. N-Cyclopentyl-L-alanine is of interest in various fields, including medicinal chemistry and biochemistry, as it may influence protein folding and function due to its unique side chain properties. Its solubility in organic solvents and limited solubility in water can affect its bioavailability and interaction with biological systems. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it a subject of study in drug design and synthesis.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-6(8(10)11)9-7-4-2-3-5-7/h6-7,9H,2-5H2,1H3,(H,10,11)/t6-/m0/s1
InChI key:InChIKey=LDUWTIUXPVCEQF-LURJTMIESA-N
SMILES:N([C@H](C(O)=O)C)C1CCCC1
Synonyms:- (2S)-2-(Cyclopentylamino)propanoic acid
- N-Cyclopentyl-L-alanine
- L-Alanine, N-cyclopentyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.