CymitQuimica logo

CAS 82017-64-9

:

N-(diaminomethylidene)-L-tyrosyl-D-alanyl-N-[(2S)-2-{[(1S)-1-(hydroxymethyl)-3-(methylsulfinyl)propyl](methyl)amino}-3-phenylpropanoyl]glycinamide

Description:
N-(diaminomethylidene)-L-tyrosyl-D-alanyl-N-[(2S)-2-{[(1S)-1-(hydroxymethyl)-3-(methylsulfinyl)propyl](methyl)amino}-3-phenylpropanoyl]glycinamide, with CAS number 82017-64-9, is a complex peptide compound characterized by its intricate structure, which includes multiple amino acid residues and functional groups. This substance features a diaminomethylidene moiety, indicating the presence of two amino groups attached to a carbon atom, which contributes to its reactivity and potential biological activity. The presence of L-tyrosine and D-alanine suggests that it may interact with biological systems, possibly influencing protein synthesis or enzyme activity. Additionally, the incorporation of a methylsulfinyl group and a hydroxymethyl group indicates potential for unique interactions in biological environments. The compound's structure suggests it may have applications in pharmaceuticals or biochemistry, particularly in the development of peptide-based therapeutics. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, making it a subject of interest for further research in medicinal chemistry.
Formula:C30H43N7O7S
InChI:InChI=1/C30H43N7O7S/c1-19(34-28(42)24(35-30(31)32)15-21-9-11-23(39)12-10-21)27(41)33-17-26(40)36-29(43)25(16-20-7-5-4-6-8-20)37(2)22(18-38)13-14-45(3)44/h4-12,19,22,24-25,38-39H,13-18H2,1-3H3,(H,33,41)(H,34,42)(H4,31,32,35)(H,36,40,43)/t19-,22+,24+,25+,45?/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.