CAS 82020-56-2

5-Bromo-2-hydroxybenzenesulfonamide

Description:

5-Bromo-2-hydroxybenzenesulfonamide, with the CAS number 82020-56-2, is an organic compound that features a sulfonamide functional group attached to a brominated phenolic structure. This compound is characterized by the presence of a bromine atom at the 5-position and a hydroxyl group at the 2-position of the benzene ring, which contributes to its reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide and hydroxyl groups. The sulfonamide moiety imparts potential biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial agents. Additionally, the bromine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions. Safety data indicates that, like many sulfonamides, it should be handled with care due to potential toxicity and allergic reactions in sensitive individuals. Overall, 5-Bromo-2-hydroxybenzenesulfonamide is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₆H₆BrNO₃S

InChI: InChI=1S/C6H6BrNO3S/c7-4-1-2-5(9)6(3-4)12(8,10)11/h1-3,9H,(H2,8,10,11)

InChI key: InChIKey=MAAWQJRCQVMKJP-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(O)C=CC(Br)=C1

Synonyms:

• 5-Bromo-2-hydroxybenzenesulfonamide
• Benzenesulfonamide, 5-bromo-2-hydroxy-