CAS 82020-62-0

2-Chloro-6-hydroxybenzenesulfonamide

Description:

2-Chloro-6-hydroxybenzenesulfonamide, with the CAS number 82020-62-0, is a chemical compound that features a sulfonamide functional group attached to a chlorinated aromatic ring. This compound is characterized by the presence of a chlorine atom at the second position and a hydroxyl group at the sixth position of the benzene ring, which contributes to its reactivity and solubility in polar solvents. The sulfonamide group imparts biological activity, making it relevant in medicinal chemistry, particularly in the development of antimicrobial agents. The compound typically exhibits moderate stability under standard conditions but may undergo hydrolysis or other reactions in the presence of strong acids or bases. Its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-Chloro-6-hydroxybenzenesulfonamide is of interest in both industrial applications and research settings due to its unique structural features and potential therapeutic uses.

Formula: C₆H₆ClNO₃S

InChI: InChI=1S/C6H6ClNO3S/c7-4-2-1-3-5(9)6(4)12(8,10)11/h1-3,9H,(H2,8,10,11)

InChI key: InChIKey=HXBDZQBWJZIPFC-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(Cl)C=CC=C1O

Synonyms:

• Benzenesulfonamide, 2-chloro-6-hydroxy-
• 2-Chloro-6-hydroxybenzenesulfonamide