CAS 820236-81-5
:methyl 2-bromo-6-fluoro-benzoate
Description:
Methyl 2-bromo-6-fluoro-benzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with both bromine and fluorine atoms. The presence of these halogens introduces unique reactivity and properties to the molecule. Typically, the bromine atom, being a good leaving group, can facilitate nucleophilic substitution reactions, while the fluorine atom can influence the compound's electronic properties and steric hindrance. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic aromatic structure. Methyl 2-bromo-6-fluoro-benzoate can be utilized in various synthetic applications, particularly in the field of medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks associated with halogenated organic compounds.
Formula:C8H6BrFO2
InChI:InChI=1/C8H6BrFO2/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4H,1H3
SMILES:COC(=O)c1c(cccc1F)Br
Synonyms:- Benzoic Acid, 2-Bromo-6-Fluoro-, Methyl Ester
- Methyl 2-bromo-6-fluorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-bromo-6-fluorobenzoate
CAS:Formula:C8H6BrFO2Purity:97%Color and Shape:LiquidMolecular weight:233.0344Methyl 2-Bromo-6-fluorobenzoate
CAS:Methyl 2-Bromo-6-fluorobenzoateFormula:C8H6BrFO2Purity:98%Color and Shape: clear. almost colourless liquidMolecular weight:233.03g/mol2-Bromo-6-fluorobenzoic acid methyl ester
CAS:2-Bromo-6-fluorobenzoic acid methyl ester is a fine chemical that belongs to the family of brominated compounds. It is a useful building block in the synthesis of diverse organic molecules, as well as a reagent for research and speciality chemicals. 2-Bromo-6-fluorobenzoic acid methyl ester is used as a versatile building block in the synthesis of complex compounds, as well as an intermediate or scaffold in organic chemistry. This product can be used to synthesize many diverse products while maintaining high quality and purity.Formula:C8H6BrFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:233.03 g/molMethyl 2-Bromo-6-fluorobenzoate
CAS:Formula:C8H6BrFO2Purity:97%Color and Shape:Liquid, ClearMolecular weight:233.036



