CAS 820236-97-3
:4-Butoxy-3-methylbenzaldehyde
Description:
4-Butoxy-3-methylbenzaldehyde, with the CAS number 820236-97-3, is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group. This compound has a butoxy group attached to the para position and a methyl group at the meta position relative to the aldehyde. It typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. The presence of the butoxy group enhances its solubility in organic solvents while the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Its molecular structure suggests it may exhibit moderate volatility and may be sensitive to oxidation. Additionally, 4-butoxy-3-methylbenzaldehyde can be utilized in the synthesis of other organic compounds and may have applications in fragrance and flavor industries due to its aromatic properties. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H16O2
InChI:InChI=1S/C12H16O2/c1-3-4-7-14-12-6-5-11(9-13)8-10(12)2/h5-6,8-9H,3-4,7H2,1-2H3
InChI key:InChIKey=OSWMOBLBJZTDBI-UHFFFAOYSA-N
SMILES:O(CCCC)C1=C(C)C=C(C=O)C=C1
Synonyms:- Benzaldehyde, 4-butoxy-3-methyl-
- 4-Butoxy-3-methylbenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.