CAS 820245-54-3

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrobromide (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrobromide (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the carboxylic acid functional group suggests it can participate in acid-base reactions, while the hydrobromide salt form indicates it is likely soluble in polar solvents, enhancing its utility in various applications. The methyl group at the 7-position may influence its pharmacological properties, potentially affecting its interaction with biological targets. As a hydrobromide, it is often used to improve the stability and solubility of the base compound in pharmaceutical formulations. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, owing to its unique structural features and potential bioactivity.

Formula: C₉H₈N₂O₂·BrH

InChI: InChI=1S/C9H8N2O2.BrH/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6;/h2-5H,1H3,(H,12,13);1H

InChI key: InChIKey=AQJKLBZVXBZICQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN2C(=N1)C=C(C)C=C2.Br

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrobromide (1:1)
• Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, monohydrobromide

7-Methyl-imidazo[1,2-a]pyridine-2-carboxylic acid hydrobromide

CAS: 820245-54-3

Formula: C₉H₉BrN₂O₂

Molecular weight: 257.087

Ref: 10-F015248