CAS 820245-79-2

3-[2-(4-Nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid

Description:

3-[2-(4-Nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid, with the CAS number 820245-79-2, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a nitrophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the nitro group, which can influence reactivity and interactions with biological targets. The propenoic acid functional group suggests that it may participate in various chemical reactions, such as polymerization or esterification. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the nitro group and the overall molecular structure. Such compounds are often of interest in medicinal chemistry and drug development, particularly for their potential therapeutic applications. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise values.

Formula: C₁₆H₁₁N₃O₄

InChI: InChI=1S/C16H11N3O4/c20-15(21)9-8-13-16(17-14-3-1-2-10-18(13)14)11-4-6-12(7-5-11)19(22)23/h1-10H,(H,20,21)

InChI key: InChIKey=PXUCWZWRFWCRQN-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(N=C2N1C=CC=C2)C3=CC=C(N(=O)=O)C=C3

Synonyms:

• 2-Propenoic acid, 3-[2-(4-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-
• 3-[2-(4-Nitrophenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid