CAS 820245-85-0

2,8-Dimethylimidazo[1,2-a]pyridine-3-carbaldehyde

Description:

2,8-Dimethylimidazo[1,2-a]pyridine-3-carbaldehyde is a heterocyclic organic compound characterized by its imidazo and pyridine rings, which contribute to its aromatic properties. This compound features two methyl groups at the 2 and 8 positions of the imidazo ring and an aldehyde functional group at the 3 position, influencing its reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the aldehyde group makes it susceptible to oxidation and nucleophilic attack, which can be utilized in various synthetic pathways. This compound is of interest in the field of medicinal chemistry and research due to its potential biological activities, including mutagenicity and carcinogenicity, often studied in the context of food safety and toxicology. Proper handling and storage are essential due to its reactive nature, and safety data sheets should be consulted for specific handling guidelines.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c1-7-4-3-5-12-9(6-13)8(2)11-10(7)12/h3-6H,1-2H3

SMILES: Cc1cccn2c(C=O)c(C)nc12

Synonyms:

• Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2,8-dimethyl-
• 2,8-Dimethyl-Imidazo[1,2-A]Pyridine-3-Carbaldehyde