CAS 82031-32-1

7-Bromo-2(1H)-quinoxalinone

Description:

7-Bromo-2(1H)-quinoxalinone is a heterocyclic organic compound characterized by its quinoxaline structure, which features a fused bicyclic system containing nitrogen atoms. The presence of a bromine atom at the 7-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-withdrawing nature of the bromine substituent. 7-Bromo-2(1H)-quinoxalinone has garnered interest in research for its potential biological activities, including antimicrobial and anticancer properties, making it a subject of investigation in drug development. Its molecular structure allows for interactions with biological targets, which can be explored further in pharmacological studies. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and reactivity.

Formula: C₈H₅BrN₂O

InChI: InChI=1/C8H5BrN2O/c9-5-1-2-6-7(3-5)11-8(12)4-10-6/h1-4H,(H,11,12)

SMILES: c1cc2c(cc1Br)[nH]c(=O)cn2

Synonyms:

• 2(1H)-quinoxalinone, 7-bromo-
• 7-Bromoquinoxalin-2(1H)-one

7-Bromoquinoxalin-2(1H)-one

CAS: 82031-32-1

Formula: C₈H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.0421

Ref: IN-DA005360

7-Bromoquinoxalin-2(1H)-one

CAS: 82031-32-1

7-Bromoquinoxalin-2(1H)-one

Purity: 97%

Molecular weight: 225.05g/mol

Ref: 54-OR75220

7-Bromo-1H-quinoxalin-2-one

CAS: 82031-32-1

Formula: C₈H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.045

Ref: 10-F076772