CymitQuimica logo

CAS 82038-68-4

:

1-(1-Piperidinyl)-2-propyn-1-one

Description:
1-(1-Piperidinyl)-2-propyn-1-one, also known by its CAS number 82038-68-4, is a chemical compound characterized by its unique structure that includes a piperidine ring and a propynone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the piperidine moiety contributes to its basicity and potential for forming salts, which can enhance its solubility and bioavailability. Additionally, the compound may exhibit various chemical reactivity patterns, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper storage and handling protocols are essential to ensure safety in laboratory environments.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-2-8(10)9-6-4-3-5-7-9/h1H,3-7H2
InChI key:InChIKey=VWWLWYUCGHGCAO-UHFFFAOYSA-N
SMILES:C(C#C)(=O)N1CCCCC1
Synonyms:
  • 2-Propyn-1-one, 1-(1-piperidinyl)-
  • 1-(1-Piperidinyl)-2-propyn-1-one
  • Piperidine, 1-(1-oxo-2-propynyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.