CAS 82050-11-1
:3H-Imidazo[4,5-f]quinolin-2-amine, 4-methyl-3-(methyl-d3)-
Description:
3H-Imidazo[4,5-f]quinolin-2-amine, 4-methyl-3-(methyl-d3)-, with CAS number 82050-11-1, is a heterocyclic organic compound characterized by its imidazoquinoline structure, which features a fused imidazole and quinoline ring system. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential biological activity, including antimicrobial or anticancer properties. The presence of the methyl group and the deuterated methyl group (methyl-d3) suggests that it may be used in studies involving isotopic labeling, which can aid in tracing metabolic pathways or understanding reaction mechanisms. The compound is likely to be soluble in organic solvents and may exhibit moderate stability under standard laboratory conditions. Its unique structure may also contribute to specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, depending on the functional groups present.
Formula:C12H9D3N4
InChI:InChI=1/C12H12N4/c1-7-6-9-8(4-3-5-14-9)10-11(7)16(2)12(13)15-10/h3-6H,1-2H3,(H2,13,15)/i2D3
InChI key:InChIKey=GMGWMIJIGUYNAY-BMSJAHLVSA-N
SMILES:CC=1C2=C(C=3C(C1)=NC=CC3)N=C(N)N2C([2H])([2H])[2H]
Synonyms:- 3H-Imidazo[4,5-f]quinolin-2-amine, 4-methyl-3-(methyl-d3)-
- 2-Amino-3-(methyl-d3)-4-methyl-3H-imidazo[4,5-f]quinoline
- MeIQ-d3
- 4-Methyl-3-(methyl-d3)-3H-imidazo[4,5-f]quinolin-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Amino-3-(methyl-d3)-4-methyl-3H-imidazo[4,5-f]quinoline
CAS:Controlled ProductStability Hygroscopic
Applications Mutagenic heterocyclic amines in cooked food.
References Stavric, B., et al.: Fd. Chem. Toxic., 31, 12, 981 (1993), Sugimura, T., et al.: Mutation Research, 290, 43 (1993), Eisenbrand & Tang: Toxicology, 84, 1 (1993)Formula:C122H3H9N4Color and Shape:NeatMolecular weight:215.27
