CAS 82055-94-5
:Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-(2-azidoethoxy)-
Description:
Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-(2-azidoethoxy)-, commonly referred to by its CAS number 82055-94-5, is a synthetic polymer characterized by its polyether backbone, which consists of repeating ethylene oxide units. The presence of azido groups at both the alpha and omega ends of the polymer chain imparts unique reactivity, making it suitable for various applications in materials science and bioconjugation. This compound is typically soluble in polar solvents, such as water and alcohols, due to its hydrophilic nature. The azido functional groups can undergo click chemistry reactions, particularly with alkynes, facilitating the formation of stable linkages in polymer networks or with biomolecules. Additionally, the polymer's structure allows for potential modifications, enhancing its versatility in drug delivery systems, surface coatings, and as a precursor for more complex materials. Safety considerations should be taken into account due to the reactive nature of azides, which can be hazardous under certain conditions.
Formula:(C2H4O)nC4H8N6O
InChI:InChI=1S/C6H12N6O2/c7-11-9-1-3-13-5-6-14-4-2-10-12-8/h1-6H2
InChI key:InChIKey=OHZGAFKSAANFAS-UHFFFAOYSA-N
SMILES:C(COCCN=[N+]=[N-])OCCN=[N+]=[N-]
Synonyms:- Poly(ethylene glycol)-diazide
- Poly(oxy-1,2-ethanediyl), α-(2-azidoethyl)-ω-(2-azidoethoxy)-
- α,ω-Diazido polyethylene glycol
- Polyethylene glycol bis(2-azidoethyl) ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Polyoxyethylene bis(azide); avg. MW 5000
CAS:Formula:N3CH2CH2(OCH2CH2)nN3Purity:(NMR) ≥ 95.0%Color and Shape:White to off-white solidPoly(ethylene glycol) bisazide
CAS:Poly(ethylene glycol) bisazide is a ligand that is used in research and as a pharmacological tool. It has been shown to inhibit the receptor for peptides, which may be due to its ability to bind with antibodies. Poly(ethylene glycol) bisazide can also be used as a research tool to study protein interactions. This ligand is known to activate ion channels and receptors. Poly(ethylene glycol) bisazide has CAS number 82055-94-5 and is of high purity.
Formula:N3CH2CH2(OCH2CH2)nN3Purity:Min. 95%Molecular weight:200.2 g/mol




