
CAS 82060-67-1
:7-Methoxy-8-quinolinecarboxaldehyde
Description:
7-Methoxy-8-quinolinecarboxaldehyde, with the CAS number 82060-67-1, is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a methoxy group (-OCH3) at the 7-position and an aldehyde group (-CHO) at the 8-position of the quinoline ring, contributing to its reactivity and potential applications in various chemical reactions. It is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The presence of the aldehyde functional group allows for participation in nucleophilic addition reactions, making it useful in organic synthesis. Additionally, compounds of this type may exhibit biological activity, including antimicrobial or antitumor properties, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H9NO2
InChI:InChI=1S/C11H9NO2/c1-14-10-5-4-8-3-2-6-12-11(8)9(10)7-13/h2-7H,1H3
InChI key:InChIKey=FUNBQTYAAUCTPN-UHFFFAOYSA-N
SMILES:C(=O)C=1C2=C(C=CC1OC)C=CC=N2
Synonyms:- 7-Methoxy-8-quinolinecarboxaldehyde
- 8-Quinolinecarboxaldehyde, 7-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.