CAS 82068-33-5
:2-[(2-Thienylsulfonyl)amino]benzoic acid
Description:
2-[(2-Thienylsulfonyl)amino]benzoic acid, with the CAS number 82068-33-5, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with an amino group and a thienylsulfonyl group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, which can influence its solubility, reactivity, and biological activity. The thienyl group contributes to its potential as a pharmacophore, while the sulfonyl group can enhance its interaction with biological targets. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit acidic properties. Additionally, the compound may show potential as a ligand in coordination chemistry or as an intermediate in organic synthesis. Its specific applications and reactivity would depend on the context of its use, particularly in medicinal chemistry or materials science. Overall, this compound's unique structural features make it of interest for various chemical and biological investigations.
Formula:C11H9NO4S2
InChI:InChI=1S/C11H9NO4S2/c13-11(14)8-4-1-2-5-9(8)12-18(15,16)10-6-3-7-17-10/h1-7,12H,(H,13,14)
InChI key:InChIKey=GKUFUBQLKZGNBO-UHFFFAOYSA-N
SMILES:N(S(=O)(=O)C1=CC=CS1)C2=C(C(O)=O)C=CC=C2
Synonyms:- Benzoic acid, 2-[(2-thienylsulfonyl)amino]-
- 2-(Thiophene-2-sulfonamido)benzoic acid
- 2-[(2-Thienylsulfonyl)amino]benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.