CAS 82068-34-6
:3-[(2-Thienylsulfonyl)amino]benzoic acid
Description:
3-[(2-Thienylsulfonyl)amino]benzoic acid, identified by its CAS number 82068-34-6, is a chemical compound characterized by the presence of a benzoic acid moiety substituted with a thienylsulfonyl group. This compound features a sulfonamide functional group, which contributes to its potential biological activity, including antimicrobial and anti-inflammatory properties. The thienyl ring, a five-membered aromatic heterocycle containing sulfur, enhances the compound's lipophilicity and may influence its interaction with biological targets. The carboxylic acid group in the benzoic acid structure provides acidic properties, allowing for potential ionization in physiological conditions. This compound may exhibit solubility in polar solvents, and its structural features suggest it could participate in hydrogen bonding, which is significant for its reactivity and interaction with other molecules. Overall, 3-[(2-Thienylsulfonyl)amino]benzoic acid is of interest in medicinal chemistry and pharmacology due to its unique structural characteristics and potential therapeutic applications.
Formula:C11H9NO4S2
InChI:InChI=1S/C11H9NO4S2/c13-11(14)8-3-1-4-9(7-8)12-18(15,16)10-5-2-6-17-10/h1-7,12H,(H,13,14)
InChI key:InChIKey=HGLIUHOTRGFJQZ-UHFFFAOYSA-N
SMILES:S(NC1=CC(C(O)=O)=CC=C1)(=O)(=O)C2=CC=CS2
Synonyms:- 3-[(2-Thienylsulfonyl)amino]benzoic acid
- Benzoic acid, 3-[(2-thienylsulfonyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.