CAS 82070-01-7
:6-Fluoro-3,4-dihydro-2H-1-benzopyran
Description:
6-Fluoro-3,4-dihydro-2H-1-benzopyran, with the CAS number 82070-01-7, is a chemical compound characterized by its bicyclic structure, which includes a benzene ring fused to a pyran ring. The presence of a fluorine atom at the 6-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate polarity and the ability to participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks. Its dihydro form indicates the presence of two hydrogen atoms that can influence its stability and reactivity. The compound may be of interest in medicinal chemistry due to its structural features, which can be modified to enhance pharmacological properties. Additionally, its synthesis and characterization are relevant in the context of developing new materials or pharmaceuticals. Overall, 6-Fluoro-3,4-dihydro-2H-1-benzopyran represents a versatile scaffold for further chemical exploration and application.
Formula:C9H9FO
InChI:InChI=1S/C9H9FO/c10-8-3-4-9-7(6-8)2-1-5-11-9/h3-4,6H,1-2,5H2
InChI key:InChIKey=AADYIFLRRCYLRF-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=CC1)OCCC2
Synonyms:- 6-Fluorochroman
- 2H-1-Benzopyran, 6-fluoro-3,4-dihydro-
- 6-Fluoro-3,4-dihydro-2H-1-benzopyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
