CAS 82080-93-1
:(2R)-2-{[(1S,2S,3R,4R,5S)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]oct-3-yl]oxy}propanoic acid (non-preferred name)
Description:
The chemical substance with the name "(2R)-2-{[(1S,2S,3R,4R,5S)-4-amino-2-hydroxy-6,8-dioxabicyclo[3.2.1]oct-3-yl]oxy}propanoic acid" and CAS number "82080-93-1" is a complex organic compound characterized by its bicyclic structure and multiple functional groups. It features an amino group, a hydroxyl group, and an ether linkage, contributing to its potential biological activity. The presence of the dioxabicyclo framework suggests it may exhibit unique stereochemical properties, which can influence its interactions in biological systems. This compound is likely to be soluble in polar solvents due to its hydroxyl and carboxylic acid functionalities, which can engage in hydrogen bonding. Its stereochemistry, indicated by the specific R and S configurations, plays a crucial role in determining its reactivity and interaction with biological targets, making it of interest in medicinal chemistry and drug design. Overall, this compound's structural complexity and functional diversity suggest potential applications in pharmaceuticals or biochemistry.
Formula:C9H15NO6
InChI:InChI=1/C9H15NO6/c1-3(8(12)13)15-7-5(10)9-14-2-4(16-9)6(7)11/h3-7,9,11H,2,10H2,1H3,(H,12,13)/t3-,4+,5-,6-,7-,9+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,6-anhydro-β-Muramic acid
CAS:Please enquire for more information about 1,6-anhydro-β-Muramic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C9H15NO6Molecular weight:233.22 g/mol
