CAS 82082-51-7
:3-Iodo-N-(phenylmethyl)benzamide
Description:
3-Iodo-N-(phenylmethyl)benzamide is an organic compound characterized by its structure, which includes a benzamide moiety substituted with an iodine atom at the 3-position and a phenylmethyl group at the nitrogen. This compound typically exhibits properties common to aromatic amides, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the amide functional group. The presence of the iodine atom can influence its reactivity and physical properties, such as increasing the molecular weight and potentially affecting the compound's electronic characteristics. The phenylmethyl group contributes to the overall hydrophobic nature of the molecule, which may impact its interactions in biological systems. Additionally, compounds like this can be of interest in medicinal chemistry for their potential biological activities, including antimicrobial or anticancer properties, due to the presence of both the iodine substituent and the aromatic rings. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of halogens.
Formula:C14H12INO
InChI:InChI=1S/C14H12INO/c15-13-8-4-7-12(9-13)14(17)16-10-11-5-2-1-3-6-11/h1-9H,10H2,(H,16,17)
InChI key:InChIKey=MESMAUTYAQSYLK-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=C1)(=O)C2=CC(I)=CC=C2
Synonyms:- 3-Iodo-N-(phenylmethyl)benzamide
- N-Benzyl-3-iodobenzamide
- Benzamide, 3-iodo-N-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
