CymitQuimica logo

CAS 821009-91-0

:

1-(1H-indol-3-yl)-2-(methylsulfonyl)ethanone

Description:
1-(1H-indol-3-yl)-2-(methylsulfonyl)ethanone, with the CAS number 821009-91-0, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methylsulfonyl group, which is a sulfonyl functional group attached to a methyl group, contributing to its chemical reactivity and solubility properties. The presence of the ethanone moiety indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can influence its biological activity and interactions. Generally, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The compound is likely to be soluble in polar solvents due to the sulfonyl group, while the indole structure may impart some degree of hydrophobicity. Its unique combination of functional groups suggests potential applications in drug development, particularly in the fields of neuropharmacology and cancer research, although specific biological activities would require empirical investigation.
Formula:C11H11NO3S
InChI:InChI=1/C11H11NO3S/c1-16(14,15)7-11(13)9-6-12-10-5-3-2-4-8(9)10/h2-6,12H,7H2,1H3
SMILES:CS(=O)(=O)CC(=O)c1c[nH]c2ccccc12
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.