CAS 82101-11-9

Benzenemethanol, 3-bromo-, 1-acetate

Description:

Benzenemethanol, 3-bromo-, 1-acetate, also known by its CAS number 82101-11-9, is an organic compound characterized by the presence of a bromine atom and an acetate functional group attached to a benzyl alcohol structure. This compound typically exhibits a molecular structure that includes a benzene ring, a hydroxymethyl group (-CH2OH), and an acetate group (-OCOCH3), contributing to its reactivity and potential applications in organic synthesis. The bromine substituent at the meta position of the benzene ring can influence the compound's electrophilic aromatic substitution reactions, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the acetate group can enhance the solubility of the compound in organic solvents, facilitating its use in various chemical reactions. Overall, the unique combination of functional groups in 3-bromo-1-acetate benzenemethanol provides diverse pathways for chemical reactivity and application in synthetic organic chemistry.

Formula: C₉H₉BrO₂

InChI: InChI=1S/C9H9BrO2/c1-7(11)12-6-8-3-2-4-9(10)5-8/h2-5H,6H2,1H3

InChI key: InChIKey=LKRBJGQCGJSSSX-UHFFFAOYSA-N

SMILES: C(OC(C)=O)C1=CC(Br)=CC=C1

Synonyms:

• 3-Bromobenzyl acetate
• Benzenemethanol, 3-bromo-, 1-acetate
• Benzenemethanol, 3-bromo-, acetate
• (3-Bromophenyl)methyl acetate