CAS 82101-17-5
:disodium (3E)-3-(2-{4-[(carboxylatomethyl)carbamoyl]phenyl}hydrazinylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate
Description:
Disodium (3E)-3-(2-{4-[(carboxylatomethyl)carbamoyl]phenyl}hydrazinylidene)-6-oxocyclohexa-1,4-diene-1-carboxylate, with CAS number 82101-17-5, is a chemical compound characterized by its complex structure, which includes multiple functional groups such as carboxylate and hydrazine moieties. This compound typically exhibits properties associated with both organic and inorganic chemistry, including solubility in polar solvents due to the presence of ionic disodium groups. Its structure suggests potential applications in pharmaceuticals or as a biochemical reagent, particularly in areas involving enzyme inhibition or as a ligand in coordination chemistry. The presence of the hydrazine group may also indicate potential reactivity in condensation reactions or as a precursor for further chemical modifications. Additionally, the compound's stability and reactivity can be influenced by pH and environmental conditions, making it important to consider these factors in practical applications. Overall, this compound represents a unique intersection of various chemical functionalities, making it of interest in both research and industrial contexts.
Formula:C16H11N3Na2O6
InChI:InChI=1/C16H13N3O6.2Na/c20-13-6-5-11(7-12(13)16(24)25)19-18-10-3-1-9(2-4-10)15(23)17-8-14(21)22;;/h1-7,18H,8H2,(H,17,23)(H,21,22)(H,24,25);;/q;2*+1/p-2/b19-11+;;
SMILES:c1cc(ccc1C(=O)NCC(=O)O)NN=C1C=CC(=O)C(=C1)C(=O)O.[Na].[Na]
Synonyms:- 5-[[4-[(Sodiooxycarbonylmethyl)carbamoyl]phenyl]azo]-2-hydroxybenzoic acid sodium salt
- 5-(Carboxymethylcarbamoyl-4-phenylazo)salicylic acid (disodium)
- Benzoic acid, 5-((4-(((carboxymethyl)amino)carbonyl)phenyl)azo)-2-hydroxy-, disodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ipsalazide
CAS:Ipsalazide is a drug used to treat bowel disease. It is an amide that has been shown to have iontophoretic properties. Ipsalazide inhibits the production of prostaglandins and leukotrienes, which are inflammatory mediators in the intestine. Ipsalazide also reduces pain, cramps, and diarrhea from colitis and other inflammatory bowel diseases. Ipsalazide should not be administered orally because of its high oral toxicity (LD50 = 2 mg/kg).Formula:C16H11N3Na2O6Purity:Min. 95%Molecular weight:387.25 g/molIpsalazide
CAS:Ipsalazide is a novel salicylazosulfapyridine analog for the treatment of inflammatory bowel disease.
Formula:C16H11N3Na2O6Purity:99.43%Color and Shape:SolidMolecular weight:387.25

