CAS 82120-25-0
:benzo[pqr]tetraphene-9,10-dione
Description:
Benzo[pqr]tetraphene-9,10-dione, with the CAS number 82120-25-0, is a polycyclic aromatic compound characterized by its complex fused ring structure. This compound features a tetracene-like framework, which consists of four fused benzene rings, and is distinguished by the presence of two carbonyl (C=O) groups at the 9 and 10 positions. The presence of these carbonyl groups imparts significant reactivity and can influence the compound's electronic properties, making it a subject of interest in organic electronics and materials science. Benzo[pqr]tetraphene-9,10-dione exhibits strong absorption in the ultraviolet-visible region, which is typical for polycyclic aromatic compounds, and may also exhibit fluorescence properties. Its unique structure and functional groups contribute to its potential applications in organic semiconductors, dyes, and as a building block in the synthesis of more complex organic materials. Additionally, the compound's stability and reactivity can vary depending on the conditions, making it a valuable subject for further research in organic chemistry and materials science.
Formula:C20H10O2
InChI:InChI=1/C20H10O2/c21-16-9-7-14-10-13-5-4-11-2-1-3-12-6-8-15(18(13)17(11)12)19(14)20(16)22/h1-10H
SMILES:c1cc2ccc3cc4C=CC(=O)C(=O)c4c4ccc(c1)c2c34
Synonyms:- Benzo[A]Pyrene-9,10-Dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzo[a]pyrene-9,10-dione
CAS:Controlled ProductFormula:C20H10O2Color and Shape:NeatMolecular weight:282.292
