CymitQuimica logo

CAS 82121-51-5

:

8-Chloro-4-hydroxy-3-quinolinemethanol

Description:
8-Chloro-4-hydroxy-3-quinolinemethanol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 8-position and a hydroxy group at the 4-position of the quinoline ring, along with a methanol functional group attached to the 3-position. The presence of these functional groups contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxyl group. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the chloro substituent may influence its reactivity and stability. As with many chemical substances, safety precautions should be observed when handling it, and its properties should be further investigated through empirical studies to fully understand its behavior in various environments.
Formula:C10H8ClNO2
InChI:InChI=1S/C10H8ClNO2/c11-8-3-1-2-7-9(8)12-4-6(5-13)10(7)14/h1-4,13H,5H2,(H,12,14)
InChI key:InChIKey=BAAKQOFDIXIXKK-UHFFFAOYSA-N
SMILES:OC=1C2=C(N=CC1CO)C(Cl)=CC=C2
Synonyms:
  • 8-Chloro-4-hydroxy-3-quinolinemethanol
  • 3-Quinolinemethanol, 8-chloro-4-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.