CAS 82131-87-1
:8-[(2-nitrobenzyl)oxy]quinoline
Description:
8-[(2-Nitrobenzyl)oxy]quinoline, with the CAS number 82131-87-1, is an organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. This compound features a nitrobenzyl group attached via an ether linkage to the 8-position of the quinoline. The presence of the nitro group (-NO2) on the benzyl moiety contributes to its electron-withdrawing properties, potentially influencing its reactivity and solubility. The compound is typically used in various chemical research applications, including studies related to fluorescence, photochemistry, and as a potential ligand in coordination chemistry. Its structural features may also impart biological activity, making it of interest in medicinal chemistry. The compound is generally stable under standard conditions but should be handled with care due to the presence of the nitro group, which can be sensitive to reduction reactions. Overall, 8-[(2-nitrobenzyl)oxy]quinoline exemplifies the intersection of organic synthesis and functional applications in chemical research.
Formula:C16H12N2O3
InChI:InChI=1/C16H12N2O3/c19-18(20)14-8-2-1-5-13(14)11-21-15-9-3-6-12-7-4-10-17-16(12)15/h1-10H,11H2
SMILES:c1ccc(c(c1)COc1cccc2cccnc12)N(=O)=O
Synonyms:- Quinoline, 8-((2-nitrophenyl)methoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.