CAS 82135-88-4

1-phenyltetrahydrothiophenium hexafluorophosphate

Description:

1-Phenyltetrahydrothiophenium hexafluorophosphate is an organic compound characterized by its unique structure, which includes a tetrahydrothiophene ring substituted with a phenyl group and a hexafluorophosphate anion. This compound typically appears as a white to light yellow solid and is known for its stability under standard conditions. The presence of the hexafluorophosphate counterion contributes to its ionic character, enhancing its solubility in polar solvents. It is often utilized in organic synthesis and as a reagent in various chemical reactions, particularly in the field of electrochemistry and as a catalyst in certain transformations. The tetrahydrothiophenium moiety can participate in nucleophilic substitution reactions, making it a versatile intermediate in synthetic chemistry. Additionally, the compound's properties, such as melting point and solubility, can vary depending on the specific conditions and purity of the sample. Safety precautions should be observed when handling this compound, as with many organofluorine compounds, due to potential toxicity and reactivity.

InChI: InChI=1/C10H13S.F6P/c1-2-6-10(7-3-1)11-8-4-5-9-11;1-7(2,3,4,5)6/h1-3,6-7H,4-5,8-9H2;/q+1;-1

Phenyltetramethylenesulphonium hexafluorophosphate

CAS: 82135-88-4

Phenyltetramethylenesulphonium hexafluorophosphate

Purity: ≥95%

Molecular weight: 310.24g/mol

Ref: 54-PC8842