CAS 82138-57-6
:6-Fluoro-1H-benzimidazole-2-propanoic acid
Description:
6-Fluoro-1H-benzimidazole-2-propanoic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole ring substituted with a fluorine atom and a propanoic acid group. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. As a benzimidazole derivative, it may exhibit pharmacological properties, including antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. The carboxylic acid functional group provides acidic characteristics, allowing for potential salt formation and influencing solubility in various solvents. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the fluorine substituent. Overall, 6-Fluoro-1H-benzimidazole-2-propanoic acid represents a versatile structure with potential applications in drug development and research.
Formula:C10H9FN2O2
InChI:InChI=1S/C10H9FN2O2/c11-6-1-2-7-8(5-6)13-9(12-7)3-4-10(14)15/h1-2,5H,3-4H2,(H,12,13)(H,14,15)
InChI key:InChIKey=BKAQRRKGTFCGHG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1NC=2C(N1)=CC(F)=CC2
Synonyms:- 1H-Benzimidazole-2-propanoic acid, 6-fluoro-
- 1H-benzimidazole-2-propanoic acid, 5-fluoro-
- 3-(5-Fluorobenzimidazol-2-yl)propionic acid
- 3-(5-fluoro-1H-benzimidazol-2-yl)propanoic acid
- 6-Fluoro-1H-benzimidazole-2-propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
