CAS 82144-26-1
:N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}-3-methoxybenzoyl)glutamic acid
Description:
N-(4-{[(2,4-diaminopteridin-6-yl)methyl](methyl)amino}-3-methoxybenzoyl)glutamic acid, with the CAS number 82144-26-1, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure that includes a glutamic acid moiety, which is an important amino acid involved in various metabolic processes. The presence of a pteridine derivative, specifically 2,4-diaminopteridin, indicates potential biological activity, particularly in relation to folate metabolism and enzyme inhibition. The methoxybenzoyl group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, reactivity, and interactions with biological targets would be crucial for understanding its potential applications in drug development.
Formula:C21H24N8O6
InChI:InChI=1/C21H24N8O6/c1-29(9-11-8-24-18-16(25-11)17(22)27-21(23)28-18)13-5-3-10(7-14(13)35-2)19(32)26-12(20(33)34)4-6-15(30)31/h3,5,7-8,12H,4,6,9H2,1-2H3,(H,26,32)(H,30,31)(H,33,34)(H4,22,23,24,27,28)/t12-/m0/s1
Synonyms:- NSC 152737
- NSC-152737
- NSC152737
- L-glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]-3-methoxybenzoyl]-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC 152737
CAS:NSC 152737 is a therapeutic agent.Formula:C21H24N8O6Color and Shape:SolidMolecular weight:484.47
