
CAS 82147-51-1
:L-γ-Glutamyl-L-cysteinylglycinamide
Description:
L-γ-Glutamyl-L-cysteinylglycinamide, identified by its CAS number 82147-51-1, is a peptide compound that plays a role in various biochemical processes. It is a derivative of glutathione, which is a tripeptide composed of glutamate, cysteine, and glycine. This compound is characterized by its involvement in antioxidant defense mechanisms, cellular signaling, and the regulation of redox states within cells. It exhibits properties typical of peptides, such as solubility in water and stability under physiological conditions. The presence of the γ-glutamyl group suggests a unique linkage that may influence its biological activity and interactions with other biomolecules. Additionally, this compound may be of interest in research related to cellular stress responses and the synthesis of other bioactive peptides. Its specific applications and effects can vary depending on the context of study, including potential therapeutic roles in oxidative stress-related conditions. Overall, L-γ-Glutamyl-L-cysteinylglycinamide represents a significant area of interest in biochemical and pharmaceutical research.
Formula:C10H18N4O5S
InChI:InChI=1S/C10H18N4O5S/c11-5(10(18)19)1-2-8(16)14-6(4-20)9(17)13-3-7(12)15/h5-6,20H,1-4,11H2,(H2,12,15)(H,13,17)(H,14,16)(H,18,19)/t5-,6-/m0/s1
InChI key:InChIKey=FBCIXVYKFFJYFT-WDSKDSINSA-N
SMILES:[C@H](C(NCC(N)=O)=O)(NC(CC[C@@H](C(O)=O)N)=O)CS
Synonyms:- Glycinamide, L-γ-glutamyl-L-cysteinyl-
- Glutathione amide
- L-γ-Glutamyl-L-cysteinylglycinamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Glutathione amide
CAS:Glutathione amide is a enzyme of a chimeric protein.Formula:C10H18N4O5SColor and Shape:SolidMolecular weight:306.34
