CymitQuimica logo

CAS 82160-07-4

:

Methylnaphthylaminomethylpyrrolidine; 97%

Description:
Methylnaphthylaminomethylpyrrolidine, with the CAS number 82160-07-4, is a chemical compound that belongs to the class of amines and is characterized by its complex structure, which includes naphthalene and pyrrolidine moieties. This compound typically appears as a solid or viscous liquid, depending on its specific formulation and purity. It is known for its potential applications in various fields, including organic synthesis and materials science, due to its unique reactivity and ability to form stable intermediates. The presence of both aromatic and aliphatic components in its structure contributes to its chemical stability and versatility. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health risks if not managed properly. Overall, methylnaphthylaminomethylpyrrolidine is a compound of interest in research and industrial applications, warranting careful study and consideration.
Formula:C16H20N2
InChI:InChI=1/C16H20N2/c1-18-11-5-8-14(18)12-17-16-10-4-7-13-6-2-3-9-15(13)16/h2-4,6-7,9-10,14,17H,5,8,11-12H2,1H3/t14-/m0/s1
SMILES:CN1CCC[C@H]1CNc1cccc2ccccc12
Synonyms:
  • (S)-(-)-1-Methyl-2-(1-naphthylaminomethyl)pyrrolidine
  • N-{[(2S)-1-methylpyrrolidin-2-yl]methyl}naphthalen-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.