CAS 82161-76-0

Indenylzirconium(IV) trichloride

Description:

Indenylzirconium(IV) trichloride, with the CAS number 82161-76-0, is an organometallic compound characterized by its zirconium center coordinated to an indenyl ligand and three chloride ions. This compound typically appears as a solid and is known for its role as a catalyst precursor in various polymerization reactions, particularly in the production of olefins and other polymers. The presence of the indenyl group provides unique electronic and steric properties, enhancing the reactivity of the zirconium center. Indenylzirconium(IV) trichloride is soluble in organic solvents, which facilitates its use in catalytic processes. Its reactivity is influenced by the nature of the ligands and the reaction conditions, making it a valuable compound in synthetic organic chemistry and materials science. Safety precautions should be observed when handling this compound, as it can be hazardous due to its reactivity and potential toxicity. Overall, its unique structure and properties make it an important compound in the field of organometallic chemistry.

Formula: C₉H₇Cl₃Zr

InChI: InChI=1/C9H7.3ClH.Zr/c1-2-5-9-7-3-6-8(9)4-1;;;;/h1-7H;3*1H;/q;;;;+3/p-3/rC9H7.Cl3Zr/c1-2-5-9-7-3-6-8(9)4-1;1-4(2)3/h1-7H;

SMILES: c1ccc2[CH]C=Cc2c1.Cl.Cl.Cl.[Zr]

Synonyms:

• Indene, Trichlorozirconium