CAS 82186-71-8

2-hydroxypropanoic acid - 7-bromo-6-chloro-3-{3-[(3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl}quinazolin-4(3H)-one (1:1)

Description:

2-Hydroxypropanoic acid - 7-bromo-6-chloro-3-{3-[(3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl}quinazolin-4(3H)-one is a complex organic compound characterized by its unique structural features, including a quinazolinone core, halogen substituents (bromine and chlorine), and a piperidine moiety. The presence of a hydroxypropanoic acid group suggests potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity due to its structural components, which could interact with various biological targets. The chirality at the piperidine ring indicates that it may exist in enantiomeric forms, potentially influencing its pharmacological properties. Additionally, the presence of multiple functional groups implies that it could participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its CAS number, 82186-71-8, allows for precise identification in chemical databases, facilitating research and application in various scientific fields. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further study.

Formula: C₁₉H₂₃BrClN₃O₆

InChI: InChI=1/C16H17BrClN3O3.C3H6O3/c17-11-6-13-10(5-12(11)18)16(24)21(8-20-13)7-9(22)4-14-15(23)2-1-3-19-14;1-2(4)3(5)6/h5-6,8,14-15,19,23H,1-4,7H2;2,4H,1H3,(H,5,6)/t14?,15-;/m1./s1

SMILES: C1C[C@H](C(CC(=O)Cn2cnc3cc(c(cc3c2=O)Cl)Br)NC1)O.CC(C(=O)O)O

Synonyms:

• Halofuginone Lactate

HALOFUGINONE LACTATE

CAS: 82186-71-8

HALOFUGINONE LACTATE

Purity: ≥98%

Molecular weight: 504.8g/mol

Ref: 54-BUP12067

HALOFUGINONE LACTATE

CAS: 82186-71-8

HALOFUGINONE LACTATE is a halogenated derivative of febrifugine, a natural quinazolinone-containing compound found in the Chinese herb D.

Formula: C₁₉H₂₃BrClN₃O₆

Purity: 99.70% - 99.96%

Color and Shape: Solid

Molecular weight: 504.8

Ref: TM-T8785

Halofuginone Lactate

CAS: 82186-71-8

Formula: C₁₆H₁₇BrClN₃O₃·C₃H₆O₃

Molecular weight: 414.68 90.08

Ref: 4Z-H-035006

Halofuginone lactate

CAS: 82186-71-8

Halogenated derivative of febrifugine; coccidiostat

Formula: C₁₉H₂₃BrClN₃O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 504.76 g/mol

Ref: 3D-FH31606

Halofuginone Lactate - MOQ

Controlled Product

CAS: 82186-71-8

Formula: C₁₆H₁₇BrClN₃O₃·C₃H₆O₃

Color and Shape: Neat

Molecular weight: 504.76

Ref: TR-H102480