CymitQuimica logo

CAS 82191-17-1

:

ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate

Description:
Ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate, identified by its CAS number 82191-17-1, is a chemical compound that belongs to the class of benzothiazine derivatives. This substance typically exhibits a complex molecular structure characterized by the presence of a benzothiazine ring fused with a carbonyl group, contributing to its unique reactivity and potential biological activity. The ethyl acetate moiety suggests that it is an ester, which often influences its solubility and volatility. Compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of the carbonyl group and the benzothiazine framework may also suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability, reactivity, and interaction with other substances can be influenced by factors such as pH, temperature, and solvent environment. Overall, ethyl 2-(3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate represents a structurally intriguing compound with potential implications in various fields of research.
Formula:C12H13NO3S
InChI:InChI=1/C12H13NO3S/c1-2-16-11(14)7-10-12(15)13-8-5-3-4-6-9(8)17-10/h3-6,10H,2,7H2,1H3,(H,13,15)
SMILES:CCOC(=O)CC1C(=Nc2ccccc2S1)O
Synonyms:
  • ethyl (3-oxo-3,4-dihydro-2H-1,4-benzothiazin-2-yl)acetate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.