CAS 82192-57-2

1-(triisopropylsilyl)-1-propyne

Description:

1-(Triisopropylsilyl)-1-propyne is an organosilicon compound characterized by the presence of a propyne functional group and a triisopropylsilyl substituent. This compound features a terminal alkyne, which is known for its reactivity in various chemical reactions, including nucleophilic additions and coupling reactions. The triisopropylsilyl group enhances the stability of the alkyne by providing steric hindrance and can also serve as a protecting group for further synthetic transformations. The presence of silicon in the structure contributes to unique properties such as increased thermal stability and potential solubility in organic solvents. Typically, compounds like this are utilized in organic synthesis, particularly in the preparation of more complex molecules or as intermediates in various chemical reactions. Additionally, the bulky triisopropylsilyl group can influence the compound's reactivity and selectivity in reactions, making it a valuable tool in synthetic organic chemistry. Overall, 1-(triisopropylsilyl)-1-propyne is a versatile compound with applications in both academic and industrial chemistry.

Formula: C₁₂H₂₄Si

InChI: InChI=1/C12H24Si/c1-8-9-13(10(2)3,11(4)5)12(6)7/h10-12H,1-7H3

SMILES: CC#C[Si](C(C)C)(C(C)C)C(C)C

Synonyms:

• Tris(1-Methylethyl)(Prop-1-Yn-1-Yl)Silane
• 1-Triisopropylsilyl-1-propyne

1-(Triisopropylsilyl)-1-propyne

CAS: 82192-57-2

Formula: C₁₂H₂₄Si

Purity: >95.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 196.41

Ref: 3B-T1690

1-Triisopropylsilyl-1-propyne

CAS: 82192-57-2

Formula: C₁₂H₂₄Si

Purity: 98%

Color and Shape: Liquid

Molecular weight: 196.4045

Ref: IN-DA003D4M

1-(Triisopropylsilyl)-1-propyne

CAS: 82192-57-2

1-(Triisopropylsilyl)-1-propyne

Purity: 95%

Molecular weight: 196.4g/mol

Ref: 54-OR1029985

1-Triisopropylsilyl-1-propyne

CAS: 82192-57-2

S18024 - 1-Triisopropylsilyl-1-propyne

Formula: C₁₂H₂₄Si

Purity: 98%

Color and Shape: Liquid, Clear

Molecular weight: 196.409

Ref: 10-S18024