
CAS 82193-29-1
:Ethyl 3-amino-6-chloroimidazo[1,2-a]pyridine-2-carboxylate
Description:
Ethyl 3-amino-6-chloroimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its imidazo-pyridine structure, which incorporates both amino and chloro functional groups. This compound typically exhibits a molecular formula that reflects its complex structure, featuring a pyridine ring fused with an imidazole moiety. The presence of the ethyl ester group contributes to its solubility properties, making it more amenable to various chemical reactions and applications. The amino group can participate in hydrogen bonding and may influence the compound's reactivity and biological activity. Additionally, the chloro substituent can enhance the compound's electrophilicity, potentially making it a useful intermediate in organic synthesis or medicinal chemistry. Ethyl 3-amino-6-chloroimidazo[1,2-a]pyridine-2-carboxylate may be of interest in pharmaceutical research due to its structural features, which could lead to the development of novel therapeutic agents. As with many chemical substances, safety data and handling precautions should be observed when working with this compound.
Formula:C10H10ClN3O2
InChI:InChI=1S/C10H10ClN3O2/c1-2-16-10(15)8-9(12)14-5-6(11)3-4-7(14)13-8/h3-5H,2,12H2,1H3
InChI key:InChIKey=JBKBWUOGNSXSMZ-UHFFFAOYSA-N
SMILES:NC=1N2C(=NC1C(OCC)=O)C=CC(Cl)=C2
Synonyms:- Ethyl 3-amino-6-chloroimidazo[1,2-a]pyridine-2-carboxylate
- Imidazo[1,2-a]pyridine-2-carboxylic acid, 3-amino-6-chloro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.