CAS 82198-76-3
:(1S,2R,18R,19R,22S,25R,28R,40S)-22-(2-amino-2-oxoethyl)-5,15-dichloro-2,18,32,35,37,48-hexahydroxy-19-{[(2R)-4-methyl-2-(methylamino)pentanoyl]amino}-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentaazaoctacyclo[26.14.2.2~3,6~.2~14,17~.1~8,12~.1~29,
Description:
The chemical substance with the name "(1S,2R,18R,19R,22S,25R,28R,40S)-22-(2-amino-2-oxoethyl)-5,15-dichloro-2,18,32,35,37,48-hexahydroxy-19-{[(2R)-4-methyl-2-(methylamino)pentanoyl]amino}-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentaazaoctacyclo[26.14.2.2~3,6~.2~14,17~.1~8,12~.1~29" and CAS number "82198-76-3" is a complex organic compound characterized by multiple functional groups and a highly intricate polycyclic structure. It features several chiral centers, indicating stereochemical specificity, which may influence its biological activity and interactions. The presence of dichloro and amino groups suggests potential reactivity and biological significance, possibly in pharmaceutical applications. The compound's extensive hydroxy and oxo functionalities imply strong hydrogen bonding capabilities, which could affect solubility and stability in various environments. Additionally, the pentaaza and dioxa components indicate a rich nitrogen and oxygen content, which may contribute to its overall polarity and reactivity. Overall, this substance exemplifies the complexity often found in bioactive molecules, particularly those with potential therapeutic uses.
Formula:C53H52Cl2N8O17
InChI:InChI=1/C53H52Cl2N8O17/c1-19(2)10-29(57-3)47(71)62-42-44(68)21-5-8-33(27(54)12-21)79-35-14-23-15-36(46(35)70)80-34-9-6-22(13-28(34)55)45(69)43-52(76)61-41(53(77)78)26-16-24(64)17-32(66)38(26)25-11-20(4-7-31(25)65)39(49(73)63-43)60-50(74)40(23)59-48(72)30(18-37(56)67)58-51(42)75/h4-9,11-17,19,29-30,39-45,57,64-66,68-70H,10,18H2,1-3H3,(H2,56,67)(H,58,75)(H,59,72)(H,60,74)(H,61,76)(H,62,71)(H,63,73)(H,77,78)/t29-,30+,39-,40-,41+,42-,43+,44-,45-/m1/s1
Synonyms:- (1S,2R,18R,19R,22S,25R,28R,40S)-22-(2-amino-2-oxoethyl)-5,15-dichloro-2,18,32,35,37,48-hexahydroxy-19-{[(2R)-4-methyl-2-(methylamino)pentanoyl]amino}-20,23,26,42,44-pentaoxo-7,13-dioxa-21,24,27,41,43-pentaazaoctacyclo[26.14.2.2~3,6~.2~14,17~.1~8,12~.1~29,33~.0~10,25~.0~34,39~]pentaconta-3,5,8(48),9,11,14,16,29(45),30,32,34,36,38,46,49-pentadecaene-40-carboxylic acid (non-preferred name)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Vancomycin Aglycon Trifluoroacetic Acid Salt Hydrate
CAS:Controlled ProductFormula:C53H52Cl2N8O17•C2HF3O2•xH2OPurity:>90%Color and Shape:NeatMolecular weight:1143.941140218Vancomycin aglycon
CAS:Vancomycin aglycon is a glycopeptide antibiotic, which is a derivative of vancomycin. It is sourced from the fermentation products of certain Amycolatopsis species, a genus of actinobacteria. The mode of action of vancomycin aglycon involves the inhibition of bacterial cell wall synthesis. It specifically binds to the D-Ala-D-Ala terminus of nascent peptidoglycan chains, thereby preventing the cross-linking that is crucial for maintaining cell wall integrity.
Formula:C53H52Cl2N8O17Purity:Min. 95%Molecular weight:1,143.93 g/mol


