CAS 82199-12-0
:N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[2-(2-methoxyphenyl)diazenyl]-3-oxobutanamide
Description:
N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[2-(2-methoxyphenyl)diazenyl]-3-oxobutanamide is a complex organic compound characterized by its unique structural features, which include a benzimidazole moiety and an azo group. The presence of the benzimidazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The azo group, characterized by the -N=N- linkage, is known for its role in dye chemistry and can influence the compound's electronic properties and reactivity. Additionally, the compound contains a butanamide functional group, which may enhance its solubility and interaction with biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's stability, solubility, and reactivity would depend on various factors, including pH and solvent conditions, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C18H17N5O4
InChI:InChI=1/C18H17N5O4/c1-10(24)16(23-22-13-5-3-4-6-15(13)27-2)17(25)19-11-7-8-12-14(9-11)21-18(26)20-12/h3-9,16H,1-2H3,(H,19,25)(H2,20,21,26)/b23-22+
InChI key:InChIKey=BWCSCOGVOJAQRL-UHFFFAOYSA-N
SMILES:N(C(C(N=NC1=C(OC)C=CC=C1)C(C)=O)=O)C=2C=C3C(=CC2)NC(=O)N3
Synonyms:- 11785
- 2-[(E)-(2-methoxyphenyl)diazenyl]-3-oxo-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)butanamide
- Benzimidazolone Yellow F2G-A
- Butanamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[(2-methoxyphenyl)azo]-3-oxo-
- Butanamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[2-(2-methoxyphenyl)diazenyl]-3-oxo-
- N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[(2-methoxyphenyl)azo]-3-oxobutyramide
- N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[2-(2-methoxyphenyl)diazenyl]-3-oxobutanamide
- N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-2-[(2-methoxyphenyl)azo]-3-oxo-Butanamide
- Novoperm Yellow F 2G
- P.Y.194
- Py 194
- Pigment Yellow 194
- C.I.Pigment Yellow 194
- C.I. Pigment Yellow 194
- BWCSCOGVOJAQRL-GHVJWSGMSA-N
- Butanamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-y l)-2-[2-(2-methoxyphenyl)diazenyl]-3-o xo-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.