
CAS 822-64-0
:3,4-Dihydro-2,5-dimethyl-2H-pyrrole
Description:
3,4-Dihydro-2,5-dimethyl-2H-pyrrole, with the CAS number 822-64-0, is a heterocyclic organic compound characterized by its five-membered ring structure containing nitrogen. This compound features two methyl groups at the 2 and 5 positions and has a saturated pyrrole framework, which contributes to its unique chemical properties. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the nitrogen atom in the ring imparts basicity and can participate in various chemical reactions, including electrophilic substitutions. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3,4-dihydro-2,5-dimethyl-2H-pyrrole may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. However, like many organic compounds, it should be handled with care, considering potential toxicity and environmental impact.
Formula:C6H11N
InChI:InChI=1S/C6H11N/c1-5-3-4-6(2)7-5/h5H,3-4H2,1-2H3
InChI key:InChIKey=HJDUCMRBFKTGNO-UHFFFAOYSA-N
SMILES:CC1N=C(C)CC1
Synonyms:- 3,4-Dihydro-2,5-dimethyl-2H-pyrrole
- 2H-Pyrrole, 3,4-dihydro-2,5-dimethyl-
- 1-Pyrroline, 2,5-dimethyl-
- 2,5-Dimethyl-1-pyrroline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.