CAS 82202-32-2

5-Bromo-4-(1,1-dimethylethyl)-2-thiazolamine

Description:

5-Bromo-4-(1,1-dimethylethyl)-2-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a bromine atom at the 5-position and a bulky tert-butyl group at the 4-position contributes to its unique chemical properties. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its thiazole moiety is known for its biological activity, often exhibiting antimicrobial or antifungal properties. The compound's solubility, stability, and reactivity can be influenced by the substituents on the thiazole ring, making it a subject of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 5-Bromo-4-(1,1-dimethylethyl)-2-thiazolamine represents a versatile structure in organic synthesis with potential applications in various fields.

Formula: C₇H₁₁BrN₂S

InChI: InChI=1S/C7H11BrN2S/c1-7(2,3)4-5(8)11-6(9)10-4/h1-3H3,(H2,9,10)

InChI key: InChIKey=ACKLPWWFGUPXSM-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(Br)SC(N)=N1

Synonyms:

• 5-Bromo-4-(1,1-dimethylethyl)-2-thiazolamine
• 2-Amino-5-bromo-4-t-butylthiazole
• 2-Thiazolamine, 5-bromo-4-(1,1-dimethylethyl)-

2-Amino-5-bromo-4-t-butylthiazole

CAS: 82202-32-2

Formula: C₇H₁₁BrN₂S

Molecular weight: 235.1446

Ref: IN-DA00G9J2

2-Amino-5-bromo-4-t-butylthiazole

CAS: 82202-32-2

2-Amino-5-bromo-4-t-butylthiazole is a heterocyclic amine that is used as a precursor to other compounds. 2-Amino-5-bromo-4-t-butylthiazole can be synthesized by the reaction of 1,2,3,4,5,6,7,8,9,10 erythrobenzothiadiazole with aniline and sulfuric acid. The kinetic isotope effect has been studied using the reactant trichloroacetamide. The mechanistic study has shown that the rate of this reaction is increased in the presence of light due to the formation of a reactive intermediate. This intermediate reacts with trichloroacetamide to form 2 amino 5 bromo 4 t butyl thiazole and cyanuric acid.

Formula: C₇H₁₁BrN₂S

Purity: Min. 95%

Molecular weight: 235.15 g/mol

Ref: 3D-HDA20232