CymitQuimica logo

CAS 82202-41-3

:

2,2,2-trichloro-N-pyridin-3-ylacetamide

Description:
2,2,2-Trichloro-N-pyridin-3-ylacetamide is a chemical compound characterized by its unique structure, which includes a pyridine ring and a trichloroacetamide functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of three chlorine atoms contributes to its reactivity and may influence its biological activity. The pyridine moiety often imparts specific properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. Additionally, the compound may exhibit antimicrobial or herbicidal properties, making it of interest in research and development. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,2,2-trichloro-N-pyridin-3-ylacetamide is a compound of interest due to its chemical characteristics and potential applications, warranting further investigation into its properties and uses.
Formula:C7H5Cl3N2O
InChI:InChI=1/C7H5Cl3N2O/c8-7(9,10)6(13)12-5-2-1-3-11-4-5/h1-4H,(H,12,13)
SMILES:c1cc(cnc1)N=C(C(Cl)(Cl)Cl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.