CAS 82208-42-2
:3-(pentafluorophenyl)propanal
Description:
3-(Pentafluorophenyl)propanal is an organic compound characterized by its unique structure, which includes a propanal group attached to a pentafluorophenyl moiety. The presence of five fluorine atoms on the phenyl ring significantly influences its chemical properties, imparting high electronegativity and making the compound highly polar. This results in increased reactivity, particularly in electrophilic aromatic substitution reactions. The compound is typically a colorless to pale yellow liquid at room temperature and has a distinct odor. Its high fluorine content contributes to its thermal stability and resistance to oxidation. Additionally, 3-(pentafluorophenyl)propanal is soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. This compound is of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in synthesizing fluorinated compounds and as a building block in drug development. Safety precautions should be taken when handling this substance, as fluorinated compounds can exhibit toxicity and environmental persistence.
Formula:C9H5F5O
InChI:InChI=1/C9H5F5O/c10-5-4(2-1-3-15)6(11)8(13)9(14)7(5)12/h3H,1-2H2
SMILES:C(Cc1c(c(c(c(c1F)F)F)F)F)C=O
Synonyms:- 3-(Pentafluorphenyl)propanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.